C12H24IN3O3S — CID 120973772
N'-[(1-methylsulfonylcyclopentyl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 120973772) has the molecular formula C12H24IN3O3S and a molecular weight of 417.31 g/mol. Its IUPAC name is N'-[(1-methylsulfonylcyclopentyl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-methylsulfonylcyclopentyl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120973772 |
| Molecular Formula | C12H24IN3O3S |
| Molecular Weight | 417.31 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | N'-[(1-methylsulfonylcyclopentyl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CS(=O)(=O)C1(C/N=C(\N)N2CCOCC2)CCCC1.I |
| InChI | InChI=1S/C12H23N3O3S.HI/c1-19(16,17)12(4-2-3-5-12)10-14-11(13)15-6-8-18-9-7-15;/h2-10H2,1H3,(H2,13,14);1H |
| InChIKey | LYIMGMCUCZJCFA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|