C8H15NO3 — CID 62066456
ethyl 1,4-oxazepane-4-carboxylate (PubChem CID 62066456) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is ethyl 1,4-oxazepane-4-carboxylate.
| Compound Name | ethyl 1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 62066456 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethyl 1,4-oxazepane-4-carboxylate |
| SMILES | CCOC(=O)N1CCCOCC1 |
| InChI | InChI=1S/C8H15NO3/c1-2-12-8(10)9-4-3-6-11-7-5-9/h2-7H2,1H3 |
| InChIKey | QCCPJYOIHFEVIS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |