About (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate
(3-ethoxy-3-oxopropyl) morpholine-4-carboxylate (PubChem CID 118111278) has the molecular formula C10H17NO5
and a molecular weight of 231.25 g/mol. Its IUPAC name is (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate.
Molecular Properties
| Compound Name | (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate |
| PubChem CID | 118111278 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate |
| SMILES | CCOC(=O)CCOC(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO5/c1-2-15-9(12)3-6-16-10(13)11-4-7-14-8-5-11/h2-8H2,1H3 |
| InChIKey | WZIPYNVGUPMBJQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate?
The IUPAC name of (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate (CID 118111278) is (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate.
What is the SMILES notation for (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate?
The canonical SMILES for (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate is CCOC(=O)CCOC(=O)N1CCOCC1.
What is the InChIKey of (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate?
The InChIKey is WZIPYNVGUPMBJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO5/c1-2-15-9(12)3-6-16-10(13)11-4-7-14-8-5-11/h2-8H2,1H3.
What are the key properties of (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate?
(3-ethoxy-3-oxopropyl) morpholine-4-carboxylate has a molecular weight of 231.25 g/mol, XLogP of 0.41, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-3-oxopropyl) morpholine-4-carboxylate is sourced from PubChem (CID 118111278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).