About [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate
[(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate (PubChem CID 159999585) has the molecular formula C15H27NO8
and a molecular weight of 349.38 g/mol. Its IUPAC name is [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate |
| PubChem CID | 159999585 |
| Molecular Formula | C15H27NO8 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@H](C)O.CCOC(=O)[C@H](C)OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C10H17NO5.C5H10O3/c1-3-15-9(12)8(2)16-10(13)11-4-6-14-7-5-11;1-3-8-5(7)4(2)6/h8H,3-7H2,1-2H3;4,6H,3H2,1-2H3/t8-;4-/m00/s1 |
| InChIKey | OHZLWZRHDZULNC-IPIKRLCPSA-N |
| XLogP | 0.34 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate?
The IUPAC name of [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate (CID 159999585) is [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate.
What is the SMILES notation for [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate?
The canonical SMILES for [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate is CCOC(=O)[C@H](C)O.CCOC(=O)[C@H](C)OC(=O)N1CCOCC1.
What is the InChIKey of [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate?
The InChIKey is OHZLWZRHDZULNC-IPIKRLCPSA-N. The full InChI is InChI=1S/C10H17NO5.C5H10O3/c1-3-15-9(12)8(2)16-10(13)11-4-6-14-7-5-11;1-3-8-5(7)4(2)6/h8H,3-7H2,1-2H3;4,6H,3H2,1-2H3/t8-;4-/m00/s1.
What are the key properties of [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate?
[(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate has a molecular weight of 349.38 g/mol, XLogP of 0.34, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-ethoxy-1-oxopropan-2-yl] morpholine-4-carboxylate;ethyl (2S)-2-hydroxypropanoate is sourced from PubChem (CID 159999585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).