C18H25F3IN3O2 — CID 111080854
N'-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111080854) has the molecular formula C18H25F3IN3O2 and a molecular weight of 499.32 g/mol. Its IUPAC name is N'-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111080854 |
| Molecular Formula | C18H25F3IN3O2 |
| Molecular Weight | 499.32 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | N'-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2cccc(C(F)(F)F)c2)CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C18H24F3N3O2.HI/c19-18(20,21)15-3-1-2-14(12-15)17(4-8-25-9-5-17)13-23-16(22)24-6-10-26-11-7-24;/h1-3,12H,4-11,13H2,(H2,22,23);1H |
| InChIKey | NVBUVJOZTHSJTM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|