C21H24F3N3O — CID 111080873
1-(4-methylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine (PubChem CID 111080873) has the molecular formula C21H24F3N3O and a molecular weight of 391.44 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine.
| Compound Name | 1-(4-methylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111080873 |
| Molecular Formula | C21H24F3N3O |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-(4-methylphenyl)-2-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CC2(c3cccc(C(F)(F)F)c3)CCOCC2)cc1 |
| InChI | InChI=1S/C21H24F3N3O/c1-15-5-7-18(8-6-15)27-19(25)26-14-20(9-11-28-12-10-20)16-3-2-4-17(13-16)21(22,23)24/h2-8,13H,9-12,14H2,1H3,(H3,25,26,27) |
| InChIKey | MNQBCVQYVIPGEY-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|