C18H20F3IN4 — CID 119148354
1-pyridin-2-yl-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide (PubChem CID 119148354) has the molecular formula C18H20F3IN4 and a molecular weight of 476.28 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-pyridin-2-yl-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119148354 |
| Molecular Formula | C18H20F3IN4 |
| Molecular Weight | 476.28 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 1-pyridin-2-yl-2-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1(c2cccc(C(F)(F)F)c2)CCC1)Nc1ccccn1 |
| InChI | InChI=1S/C18H19F3N4.HI/c19-18(20,21)14-6-3-5-13(11-14)17(8-4-9-17)12-24-16(22)25-15-7-1-2-10-23-15;/h1-3,5-7,10-11H,4,8-9,12H2,(H3,22,23,24,25);1H |
| InChIKey | NVWKNFRZVJTIAR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|