C12H19IN4S — CID 120605860
2-[(1-methylsulfanylcyclobutyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 120605860) has the molecular formula C12H19IN4S and a molecular weight of 378.28 g/mol. Its IUPAC name is 2-[(1-methylsulfanylcyclobutyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(1-methylsulfanylcyclobutyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120605860 |
| Molecular Formula | C12H19IN4S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-[(1-methylsulfanylcyclobutyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | CSC1(C/N=C(\N)Nc2ccccn2)CCC1.I |
| InChI | InChI=1S/C12H18N4S.HI/c1-17-12(6-4-7-12)9-15-11(13)16-10-5-2-3-8-14-10;/h2-3,5,8H,4,6-7,9H2,1H3,(H3,13,14,15,16);1H |
| InChIKey | WBSIEMNOQRWLQP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|