C18H21BrN4 — CID 119934704
2-[[1-(3-bromophenyl)cyclopentyl]methyl]-1-pyridin-2-ylguanidine (PubChem CID 119934704) has the molecular formula C18H21BrN4 and a molecular weight of 373.30 g/mol. Its IUPAC name is 2-[[1-(3-bromophenyl)cyclopentyl]methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[[1-(3-bromophenyl)cyclopentyl]methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 119934704 |
| Molecular Formula | C18H21BrN4 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-[[1-(3-bromophenyl)cyclopentyl]methyl]-1-pyridin-2-ylguanidine |
| SMILES | N/C(=N\CC1(c2cccc(Br)c2)CCCC1)Nc1ccccn1 |
| InChI | InChI=1S/C18H21BrN4/c19-15-7-5-6-14(12-15)18(9-2-3-10-18)13-22-17(20)23-16-8-1-4-11-21-16/h1,4-8,11-12H,2-3,9-10,13H2,(H3,20,21,22,23) |
| InChIKey | JUQBSMPYFXFKSM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|