C17H18Cl2N4 — CID 120581767
2-[[1-(2,6-dichlorophenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine (PubChem CID 120581767) has the molecular formula C17H18Cl2N4 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-[[1-(2,6-dichlorophenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[[1-(2,6-dichlorophenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 120581767 |
| Molecular Formula | C17H18Cl2N4 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-[[1-(2,6-dichlorophenyl)cyclobutyl]methyl]-1-pyridin-2-ylguanidine |
| SMILES | N/C(=N\CC1(c2c(Cl)cccc2Cl)CCC1)Nc1ccccn1 |
| InChI | InChI=1S/C17H18Cl2N4/c18-12-5-3-6-13(19)15(12)17(8-4-9-17)11-22-16(20)23-14-7-1-2-10-21-14/h1-3,5-7,10H,4,8-9,11H2,(H3,20,21,22,23) |
| InChIKey | BPWICWSSCMOHRU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|