C17H27N5S — CID 119147612
1-pyridin-2-yl-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 119147612) has the molecular formula C17H27N5S and a molecular weight of 333.50 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-pyridin-2-yl-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 119147612 |
| Molecular Formula | C17H27N5S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.20 |
| IUPAC Name | 1-pyridin-2-yl-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | N/C(=N\CC1(N2CCSCC2)CCCCC1)Nc1ccccn1 |
| InChI | InChI=1S/C17H27N5S/c18-16(21-15-6-2-5-9-19-15)20-14-17(7-3-1-4-8-17)22-10-12-23-13-11-22/h2,5-6,9H,1,3-4,7-8,10-14H2,(H3,18,19,20,21) |
| InChIKey | FDSODUWTDJRMEN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|