C21H32N4OS — CID 111811584
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine (PubChem CID 111811584) has the molecular formula C21H32N4OS and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111811584 |
| Molecular Formula | C21H32N4OS |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine |
| SMILES | N/C(=N\CC1(N2CCSCC2)CCCCC1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C21H32N4OS/c22-20(24-18-8-13-26-19-7-3-2-6-17(18)19)23-16-21(9-4-1-5-10-21)25-11-14-27-15-12-25/h2-3,6-7,18H,1,4-5,8-16H2,(H3,22,23,24) |
| InChIKey | NNSKJUPRYHRYPZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|