C18H25N3OS — CID 122101615
1-(3,4-dihydro-2H-chromen-4-yl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine (PubChem CID 122101615) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 122101615 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-(6-thiaspiro[2.5]octan-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC1CC12CCSCC2)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C18H25N3OS/c19-17(20-12-13-11-18(13)6-9-23-10-7-18)21-15-5-8-22-16-4-2-1-3-14(15)16/h1-4,13,15H,5-12H2,(H3,19,20,21) |
| InChIKey | XLGUSRPUVKXQTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|