C18H25F3N4OS — CID 111067632
2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111067632) has the molecular formula C18H25F3N4OS and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111067632 |
| Molecular Formula | C18H25F3N4OS |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CC1(N2CCSCC2)CCCC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N4OS/c19-18(20,21)26-15-5-3-14(4-6-15)24-16(22)23-13-17(7-1-2-8-17)25-9-11-27-12-10-25/h3-6H,1-2,7-13H2,(H3,22,23,24) |
| InChIKey | BXWXJEIHNHCGHG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|