C14H24IN5 — CID 119117281
2-[[1-(dimethylamino)cyclopentyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 119117281) has the molecular formula C14H24IN5 and a molecular weight of 389.29 g/mol. Its IUPAC name is 2-[[1-(dimethylamino)cyclopentyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-[[1-(dimethylamino)cyclopentyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119117281 |
| Molecular Formula | C14H24IN5 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | 2-[[1-(dimethylamino)cyclopentyl]methyl]-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | CN(C)C1(C/N=C(\N)Nc2ccccn2)CCCC1.I |
| InChI | InChI=1S/C14H23N5.HI/c1-19(2)14(8-4-5-9-14)11-17-13(15)18-12-7-3-6-10-16-12;/h3,6-7,10H,4-5,8-9,11H2,1-2H3,(H3,15,16,17,18);1H |
| InChIKey | NCJOTPQIMPZOQQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|