C13H19F2IN4 — CID 120762620
2-[(4,4-difluorocyclohexyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide (PubChem CID 120762620) has the molecular formula C13H19F2IN4 and a molecular weight of 396.22 g/mol. Its IUPAC name is 2-[(4,4-difluorocyclohexyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(4,4-difluorocyclohexyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120762620 |
| Molecular Formula | C13H19F2IN4 |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 2-[(4,4-difluorocyclohexyl)methyl]-1-pyridin-2-ylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCC(F)(F)CC1)Nc1ccccn1 |
| InChI | InChI=1S/C13H18F2N4.HI/c14-13(15)6-4-10(5-7-13)9-18-12(16)19-11-3-1-2-8-17-11;/h1-3,8,10H,4-7,9H2,(H3,16,17,18,19);1H |
| InChIKey | BDQLBHHUPARYFL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|