C9H12F3IN4O — CID 119118280
1-pyridin-2-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide (PubChem CID 119118280) has the molecular formula C9H12F3IN4O and a molecular weight of 376.12 g/mol. Its IUPAC name is 1-pyridin-2-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide.
| Compound Name | 1-pyridin-2-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119118280 |
| Molecular Formula | C9H12F3IN4O |
| Molecular Weight | 376.12 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 1-pyridin-2-yl-2-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC(O)C(F)(F)F)Nc1ccccn1 |
| InChI | InChI=1S/C9H11F3N4O.HI/c10-9(11,12)6(17)5-15-8(13)16-7-3-1-2-4-14-7;/h1-4,6,17H,5H2,(H3,13,14,15,16);1H |
| InChIKey | QFYFZRWZYSEEDC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.12 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|