C11H18IN5O — CID 119119560
3-[[amino-(pyridin-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide (PubChem CID 119119560) has the molecular formula C11H18IN5O and a molecular weight of 363.20 g/mol. Its IUPAC name is 3-[[amino-(pyridin-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-(pyridin-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 119119560 |
| Molecular Formula | C11H18IN5O |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 3-[[amino-(pyridin-2-ylamino)methylidene]amino]-2,2-dimethylpropanamide;hydroiodide |
| SMILES | CC(C)(C/N=C(\N)Nc1ccccn1)C(N)=O.I |
| InChI | InChI=1S/C11H17N5O.HI/c1-11(2,9(12)17)7-15-10(13)16-8-5-3-4-6-14-8;/h3-6H,7H2,1-2H3,(H2,12,17)(H3,13,14,15,16);1H |
| InChIKey | ODHVDRKJVNGEQH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|