C10H15N5O — CID 70506884
1-(N'-propylcarbamimidoyl)-3-pyridin-2-ylurea (PubChem CID 70506884) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is 1-(N'-propylcarbamimidoyl)-3-pyridin-2-ylurea.
| Compound Name | 1-(N'-propylcarbamimidoyl)-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 70506884 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 1-(N'-propylcarbamimidoyl)-3-pyridin-2-ylurea |
| SMILES | CCC/N=C(\N)NC(=O)Nc1ccccn1 |
| InChI | InChI=1S/C10H15N5O/c1-2-6-13-9(11)15-10(16)14-8-5-3-4-7-12-8/h3-5,7H,2,6H2,1H3,(H4,11,12,13,14,15,16) |
| InChIKey | FLVJBMGZBRIBJV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|