C11H13N5OS — CID 110491785
1-(5-propyl-1,3,4-thiadiazol-2-yl)-3-pyridin-2-ylurea (PubChem CID 110491785) has the molecular formula C11H13N5OS and a molecular weight of 263.33 g/mol. Its IUPAC name is 1-(5-propyl-1,3,4-thiadiazol-2-yl)-3-pyridin-2-ylurea.
| Compound Name | 1-(5-propyl-1,3,4-thiadiazol-2-yl)-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 110491785 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-(5-propyl-1,3,4-thiadiazol-2-yl)-3-pyridin-2-ylurea |
| SMILES | CCCc1nnc(NC(=O)Nc2ccccn2)s1 |
| InChI | InChI=1S/C11H13N5OS/c1-2-5-9-15-16-11(18-9)14-10(17)13-8-6-3-4-7-12-8/h3-4,6-7H,2,5H2,1H3,(H2,12,13,14,16,17) |
| InChIKey | LVVDPNYBGPREHI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |