C11H12N4OS — CID 717037
N-(5-propyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide (PubChem CID 717037) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N-(5-propyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide.
| Compound Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 717037 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-(5-propyl-1,3,4-thiadiazol-2-yl)pyridine-2-carboxamide |
| SMILES | CCCc1nnc(NC(=O)c2ccccn2)s1 |
| InChI | InChI=1S/C11H12N4OS/c1-2-5-9-14-15-11(17-9)13-10(16)8-6-3-4-7-12-8/h3-4,6-7H,2,5H2,1H3,(H,13,15,16) |
| InChIKey | YLIXOWXKFVUKRS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |