C10H18N4OS — CID 47199526
1-butyl-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea (PubChem CID 47199526) has the molecular formula C10H18N4OS and a molecular weight of 242.35 g/mol. Its IUPAC name is 1-butyl-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea.
| Compound Name | 1-butyl-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
|---|---|
| PubChem CID | 47199526 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-butyl-3-(5-propyl-1,3,4-thiadiazol-2-yl)urea |
| SMILES | CCCCNC(=O)Nc1nnc(CCC)s1 |
| InChI | InChI=1S/C10H18N4OS/c1-3-5-7-11-9(15)12-10-14-13-8(16-10)6-4-2/h3-7H2,1-2H3,(H2,11,12,14,15) |
| InChIKey | BSYNFYXCJQFDAR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|