C7H9Cl2N3OS — CID 19189341
2,2-dichloro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 19189341) has the molecular formula C7H9Cl2N3OS and a molecular weight of 254.14 g/mol. Its IUPAC name is 2,2-dichloro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2,2-dichloro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19189341 |
| Molecular Formula | C7H9Cl2N3OS |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 252.98 |
| IUPAC Name | 2,2-dichloro-N-(5-propyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCCc1nnc(NC(=O)C(Cl)Cl)s1 |
| InChI | InChI=1S/C7H9Cl2N3OS/c1-2-3-4-11-12-7(14-4)10-6(13)5(8)9/h5H,2-3H2,1H3,(H,10,12,13) |
| InChIKey | XJHLDWMORASYBC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|