C15H17Cl2N5O2S — CID 78875092
3,4-dichloro-N-[2-[(5-propyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]benzamide (PubChem CID 78875092) has the molecular formula C15H17Cl2N5O2S and a molecular weight of 402.31 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(5-propyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(5-propyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 78875092 |
| Molecular Formula | C15H17Cl2N5O2S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 3,4-dichloro-N-[2-[(5-propyl-1,3,4-thiadiazol-2-yl)carbamoylamino]ethyl]benzamide |
| SMILES | CCCc1nnc(NC(=O)NCCNC(=O)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C15H17Cl2N5O2S/c1-2-3-12-21-22-15(25-12)20-14(24)19-7-6-18-13(23)9-4-5-10(16)11(17)8-9/h4-5,8H,2-3,6-7H2,1H3,(H,18,23)(H2,19,20,22,24) |
| InChIKey | GPGQWBFYJUQCCZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|