C12H12Cl2N4OS — CID 92659568
N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dichlorobenzamide (PubChem CID 92659568) has the molecular formula C12H12Cl2N4OS and a molecular weight of 331.23 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dichlorobenzamide.
| Compound Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 92659568 |
| Molecular Formula | C12H12Cl2N4OS |
| Molecular Weight | 331.23 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dichlorobenzamide |
| SMILES | Nc1nnc(CCCNC(=O)c2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H12Cl2N4OS/c13-8-4-3-7(6-9(8)14)11(19)16-5-1-2-10-17-18-12(15)20-10/h3-4,6H,1-2,5H2,(H2,15,18)(H,16,19) |
| InChIKey | ZTWDMQRUHXVRPT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|