C19H19N5O2S — CID 92659801
N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3-benzamidobenzamide (PubChem CID 92659801) has the molecular formula C19H19N5O2S and a molecular weight of 381.46 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3-benzamidobenzamide.
| Compound Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3-benzamidobenzamide |
|---|---|
| PubChem CID | 92659801 |
| Molecular Formula | C19H19N5O2S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3-benzamidobenzamide |
| SMILES | Nc1nnc(CCCNC(=O)c2cccc(NC(=O)c3ccccc3)c2)s1 |
| InChI | InChI=1S/C19H19N5O2S/c20-19-24-23-16(27-19)10-5-11-21-17(25)14-8-4-9-15(12-14)22-18(26)13-6-2-1-3-7-13/h1-4,6-9,12H,5,10-11H2,(H2,20,24)(H,21,25)(H,22,26) |
| InChIKey | MXHLZZIPAMSTOY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|