C18H25N5OS — CID 72855136
N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-(piperidin-1-ylmethyl)benzamide (PubChem CID 72855136) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-(piperidin-1-ylmethyl)benzamide.
| Compound Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-(piperidin-1-ylmethyl)benzamide |
|---|---|
| PubChem CID | 72855136 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-(piperidin-1-ylmethyl)benzamide |
| SMILES | Nc1nnc(CCCNC(=O)c2ccc(CN3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C18H25N5OS/c19-18-22-21-16(25-18)5-4-10-20-17(24)15-8-6-14(7-9-15)13-23-11-2-1-3-12-23/h6-9H,1-5,10-13H2,(H2,19,22)(H,20,24) |
| InChIKey | NNGBHPOZNYFZLI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|