C17H23N5OS — CID 97207201
N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-[(3R)-piperidin-3-yl]benzamide (PubChem CID 97207201) has the molecular formula C17H23N5OS and a molecular weight of 345.47 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-[(3R)-piperidin-3-yl]benzamide.
| Compound Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-[(3R)-piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 97207201 |
| Molecular Formula | C17H23N5OS |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-4-[(3R)-piperidin-3-yl]benzamide |
| SMILES | Nc1nnc(CCCNC(=O)c2ccc([C@H]3CCCNC3)cc2)s1 |
| InChI | InChI=1S/C17H23N5OS/c18-17-22-21-15(24-17)4-2-10-20-16(23)13-7-5-12(6-8-13)14-3-1-9-19-11-14/h5-8,14,19H,1-4,9-11H2,(H2,18,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | MQIKVHIAVPJDIR-AWEZNQCLSA-N |
| XLogP | 1.95 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|