C16H25N3O3S — CID 77084725
N-[2-(dimethylsulfamoyl)ethyl]-4-piperidin-3-ylbenzamide (PubChem CID 77084725) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is N-[2-(dimethylsulfamoyl)ethyl]-4-piperidin-3-ylbenzamide.
| Compound Name | N-[2-(dimethylsulfamoyl)ethyl]-4-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 77084725 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[2-(dimethylsulfamoyl)ethyl]-4-piperidin-3-ylbenzamide |
| SMILES | CN(C)S(=O)(=O)CCNC(=O)c1ccc(C2CCCNC2)cc1 |
| InChI | InChI=1S/C16H25N3O3S/c1-19(2)23(21,22)11-10-18-16(20)14-7-5-13(6-8-14)15-4-3-9-17-12-15/h5-8,15,17H,3-4,9-12H2,1-2H3,(H,18,20) |
| InChIKey | UWUULLBFJQBLCZ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |