C14H18N4O3S — CID 92659573
N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dimethoxybenzamide (PubChem CID 92659573) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 92659573 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[3-(5-amino-1,3,4-thiadiazol-2-yl)propyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCCc2nnc(N)s2)cc1OC |
| InChI | InChI=1S/C14H18N4O3S/c1-20-10-6-5-9(8-11(10)21-2)13(19)16-7-3-4-12-17-18-14(15)22-12/h5-6,8H,3-4,7H2,1-2H3,(H2,15,18)(H,16,19) |
| InChIKey | QHRNOESEYFQMQE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|