C14H18N4O4S — CID 92659644
N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4,5-trimethoxybenzamide (PubChem CID 92659644) has the molecular formula C14H18N4O4S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 92659644 |
| Molecular Formula | C14H18N4O4S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCCc2nnc(N)s2)cc(OC)c1OC |
| InChI | InChI=1S/C14H18N4O4S/c1-20-9-6-8(7-10(21-2)12(9)22-3)13(19)16-5-4-11-17-18-14(15)23-11/h6-7H,4-5H2,1-3H3,(H2,15,18)(H,16,19) |
| InChIKey | MRVHWQHFVUHMOQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |