C15H18N2O5 — CID 47728397
3,4,5-trimethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide (PubChem CID 47728397) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 47728397 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCc2cc(C)on2)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N2O5/c1-9-5-11(17-22-9)8-16-15(18)10-6-12(19-2)14(21-4)13(7-10)20-3/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | KMBMLDWJAPFZAH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |