C16H20N2O4 — CID 47900987
3,4-diethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide (PubChem CID 47900987) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is 3,4-diethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 47900987 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 3,4-diethoxy-N-[(5-methyl-1,2-oxazol-3-yl)methyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCc2cc(C)on2)cc1OCC |
| InChI | InChI=1S/C16H20N2O4/c1-4-20-14-7-6-12(9-15(14)21-5-2)16(19)17-10-13-8-11(3)22-18-13/h6-9H,4-5,10H2,1-3H3,(H,17,19) |
| InChIKey | SCLKNKFCSRULRN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |