C11H10N6O5S — CID 92659476
N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,5-dinitrobenzamide (PubChem CID 92659476) has the molecular formula C11H10N6O5S and a molecular weight of 338.31 g/mol. Its IUPAC name is N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,5-dinitrobenzamide.
| Compound Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 92659476 |
| Molecular Formula | C11H10N6O5S |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | N-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]-3,5-dinitrobenzamide |
| SMILES | Nc1nnc(CCNC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)s1 |
| InChI | InChI=1S/C11H10N6O5S/c12-11-15-14-9(23-11)1-2-13-10(18)6-3-7(16(19)20)5-8(4-6)17(21)22/h3-5H,1-2H2,(H2,12,15)(H,13,18) |
| InChIKey | WYJMSHGTOYKHHO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 167.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|