C18H14ClN5O4S — CID 17193080
2-chloro-N-[2-[5-[(3-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide (PubChem CID 17193080) has the molecular formula C18H14ClN5O4S and a molecular weight of 431.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[5-[(3-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[5-[(3-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17193080 |
| Molecular Formula | C18H14ClN5O4S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-chloro-N-[2-[5-[(3-nitrobenzoyl)amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
| SMILES | O=C(Nc1nnc(CCNC(=O)c2ccccc2Cl)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H14ClN5O4S/c19-14-7-2-1-6-13(14)17(26)20-9-8-15-22-23-18(29-15)21-16(25)11-4-3-5-12(10-11)24(27)28/h1-7,10H,8-9H2,(H,20,26)(H,21,23,25) |
| InChIKey | ZHEPKAVJMUTXOX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|