C16H11FN4O4S — CID 3148817
N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-nitrobenzamide (PubChem CID 3148817) has the molecular formula C16H11FN4O4S and a molecular weight of 374.35 g/mol. Its IUPAC name is N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-nitrobenzamide.
| Compound Name | N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3148817 |
| Molecular Formula | C16H11FN4O4S |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-3-nitrobenzamide |
| SMILES | O=C(Nc1nnc(COc2ccccc2F)s1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11FN4O4S/c17-12-6-1-2-7-13(12)25-9-14-19-20-16(26-14)18-15(22)10-4-3-5-11(8-10)21(23)24/h1-8H,9H2,(H,18,20,22) |
| InChIKey | FRTODBFDZQYGEU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|