C19H18ClFN4O2S — CID 68763731
N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride (PubChem CID 68763731) has the molecular formula C19H18ClFN4O2S and a molecular weight of 420.90 g/mol. Its IUPAC name is N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride.
| Compound Name | N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68763731 |
| Molecular Formula | C19H18ClFN4O2S |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-[5-[(2-fluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(COc2ccccc2F)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C19H17FN4O2S.ClH/c20-15-3-1-2-4-16(15)26-11-17-23-24-19(27-17)22-18(25)13-5-6-14-10-21-8-7-12(14)9-13;/h1-6,9,21H,7-8,10-11H2,(H,22,24,25);1H |
| InChIKey | SCMYWILRZOQAAU-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |