C19H18Cl2N4OS — CID 68763771
N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride (PubChem CID 68763771) has the molecular formula C19H18Cl2N4OS and a molecular weight of 421.35 g/mol. Its IUPAC name is N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride.
| Compound Name | N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68763771 |
| Molecular Formula | C19H18Cl2N4OS |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | N-[5-[(3-chlorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(Cc2cccc(Cl)c2)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C19H17ClN4OS.ClH/c20-16-3-1-2-12(8-16)9-17-23-24-19(26-17)22-18(25)14-4-5-15-11-21-7-6-13(15)10-14;/h1-5,8,10,21H,6-7,9,11H2,(H,22,24,25);1H |
| InChIKey | BGQZDJMBUVEGGV-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |