C20H20Cl2N4O2S — CID 68768174
N-[5-[2-(2-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride (PubChem CID 68768174) has the molecular formula C20H20Cl2N4O2S and a molecular weight of 451.38 g/mol. Its IUPAC name is N-[5-[2-(2-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride.
| Compound Name | N-[5-[2-(2-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68768174 |
| Molecular Formula | C20H20Cl2N4O2S |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | N-[5-[2-(2-chlorophenoxy)ethyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(CCOc2ccccc2Cl)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C20H19ClN4O2S.ClH/c21-16-3-1-2-4-17(16)27-10-8-18-24-25-20(28-18)23-19(26)14-5-6-15-12-22-9-7-13(15)11-14;/h1-6,11,22H,7-10,12H2,(H,23,25,26);1H |
| InChIKey | BHACMXYXADHAGN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |