C20H18ClF3N4OS — CID 68764988
N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride (PubChem CID 68764988) has the molecular formula C20H18ClF3N4OS and a molecular weight of 454.91 g/mol. Its IUPAC name is N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride.
| Compound Name | N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68764988 |
| Molecular Formula | C20H18ClF3N4OS |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-[5-[[4-(trifluoromethyl)phenyl]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(Cc2ccc(C(F)(F)F)cc2)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C20H17F3N4OS.ClH/c21-20(22,23)16-5-1-12(2-6-16)9-17-26-27-19(29-17)25-18(28)14-3-4-15-11-24-8-7-13(15)10-14;/h1-6,10,24H,7-9,11H2,(H,25,27,28);1H |
| InChIKey | XUDSBHQJPQCYIU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |