C19H15F3N4OS — CID 25011866
N-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 25011866) has the molecular formula C19H15F3N4OS and a molecular weight of 404.42 g/mol. Its IUPAC name is N-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 25011866 |
| Molecular Formula | C19H15F3N4OS |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | N-[5-[3-(trifluoromethyl)phenyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | O=C(Nc1nnc(-c2cccc(C(F)(F)F)c2)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C19H15F3N4OS/c20-19(21,22)15-3-1-2-13(9-15)17-25-26-18(28-17)24-16(27)12-4-5-14-10-23-7-6-11(14)8-12/h1-5,8-9,23H,6-7,10H2,(H,24,26,27) |
| InChIKey | XLVFUVPMYBVZLD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |