C27H24F3N5O2 — CID 138481256
N-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 138481256) has the molecular formula C27H24F3N5O2 and a molecular weight of 507.52 g/mol. Its IUPAC name is N-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 138481256 |
| Molecular Formula | C27H24F3N5O2 |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | N-[4-[4-methyl-5-[[3-(trifluoromethyl)phenoxy]methyl]-1,2,4-triazol-3-yl]phenyl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | Cn1c(COc2cccc(C(F)(F)F)c2)nnc1-c1ccc(NC(=O)c2ccc3c(c2)CCNC3)cc1 |
| InChI | InChI=1S/C27H24F3N5O2/c1-35-24(16-37-23-4-2-3-21(14-23)27(28,29)30)33-34-25(35)17-7-9-22(10-8-17)32-26(36)19-5-6-20-15-31-12-11-18(20)13-19/h2-10,13-14,31H,11-12,15-16H2,1H3,(H,32,36) |
| InChIKey | SBGQZEODVXWZFG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |