C17H9F6N3OS — CID 18273975
N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide (PubChem CID 18273975) has the molecular formula C17H9F6N3OS and a molecular weight of 417.33 g/mol. Its IUPAC name is N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18273975 |
| Molecular Formula | C17H9F6N3OS |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-(5-phenyl-1,3,4-thiadiazol-2-yl)-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F6N3OS/c18-16(19,20)11-6-10(7-12(8-11)17(21,22)23)13(27)24-15-26-25-14(28-15)9-4-2-1-3-5-9/h1-8H,(H,24,26,27) |
| InChIKey | YLTJSNALSLWUCI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |