C20H17Cl2F3N4O2S — CID 68763325
N-[5-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride (PubChem CID 68763325) has the molecular formula C20H17Cl2F3N4O2S and a molecular weight of 505.35 g/mol. Its IUPAC name is N-[5-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride.
| Compound Name | N-[5-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 68763325 |
| Molecular Formula | C20H17Cl2F3N4O2S |
| Molecular Weight | 505.35 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | N-[5-[[2-chloro-4-(trifluoromethyl)phenoxy]methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide;hydrochloride |
| SMILES | Cl.O=C(Nc1nnc(COc2ccc(C(F)(F)F)cc2Cl)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C20H16ClF3N4O2S.ClH/c21-15-8-14(20(22,23)24)3-4-16(15)30-10-17-27-28-19(31-17)26-18(29)12-1-2-13-9-25-6-5-11(13)7-12;/h1-4,7-8,25H,5-6,9-10H2,(H,26,28,29);1H |
| InChIKey | INBJONJPHCBXND-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.35 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |