C19H16F2N4O2S — CID 25012852
N-[5-[(2,4-difluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide (PubChem CID 25012852) has the molecular formula C19H16F2N4O2S and a molecular weight of 402.43 g/mol. Its IUPAC name is N-[5-[(2,4-difluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide.
| Compound Name | N-[5-[(2,4-difluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 25012852 |
| Molecular Formula | C19H16F2N4O2S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[5-[(2,4-difluorophenoxy)methyl]-1,3,4-thiadiazol-2-yl]-1,2,3,4-tetrahydroisoquinoline-6-carboxamide |
| SMILES | O=C(Nc1nnc(COc2ccc(F)cc2F)s1)c1ccc2c(c1)CCNC2 |
| InChI | InChI=1S/C19H16F2N4O2S/c20-14-3-4-16(15(21)8-14)27-10-17-24-25-19(28-17)23-18(26)12-1-2-13-9-22-6-5-11(13)7-12/h1-4,7-8,22H,5-6,9-10H2,(H,23,25,26) |
| InChIKey | JGDCKPPVEMOOCA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |