C20H18N6O7S — CID 17193420
N-[5-[2-[(3-methoxybenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-2-methyl-3,5-dinitrobenzamide (PubChem CID 17193420) has the molecular formula C20H18N6O7S and a molecular weight of 486.47 g/mol. Its IUPAC name is N-[5-[2-[(3-methoxybenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-2-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[5-[2-[(3-methoxybenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-2-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 17193420 |
| Molecular Formula | C20H18N6O7S |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | N-[5-[2-[(3-methoxybenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-2-methyl-3,5-dinitrobenzamide |
| SMILES | COc1cccc(C(=O)NCCc2nnc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3C)s2)c1 |
| InChI | InChI=1S/C20H18N6O7S/c1-11-15(9-13(25(29)30)10-16(11)26(31)32)19(28)22-20-24-23-17(34-20)6-7-21-18(27)12-4-3-5-14(8-12)33-2/h3-5,8-10H,6-7H2,1-2H3,(H,21,27)(H,22,24,28) |
| InChIKey | ONNLSBLTSMREOJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|