C15H17ClN4O3S — CID 94831015
N-[2-[5-(3-chloropropanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-3-methoxybenzamide (PubChem CID 94831015) has the molecular formula C15H17ClN4O3S and a molecular weight of 368.85 g/mol. Its IUPAC name is N-[2-[5-(3-chloropropanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-3-methoxybenzamide.
| Compound Name | N-[2-[5-(3-chloropropanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 94831015 |
| Molecular Formula | C15H17ClN4O3S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-[2-[5-(3-chloropropanoylamino)-1,3,4-thiadiazol-2-yl]ethyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)NCCc2nnc(NC(=O)CCCl)s2)c1 |
| InChI | InChI=1S/C15H17ClN4O3S/c1-23-11-4-2-3-10(9-11)14(22)17-8-6-13-19-20-15(24-13)18-12(21)5-7-16/h2-4,9H,5-8H2,1H3,(H,17,22)(H,18,20,21) |
| InChIKey | IYTQHBBRBXUALG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|