C19H16BrN5O5S — CID 17193269
N-[5-[2-[(3-bromobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-3-nitrobenzamide (PubChem CID 17193269) has the molecular formula C19H16BrN5O5S and a molecular weight of 506.34 g/mol. Its IUPAC name is N-[5-[2-[(3-bromobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-3-nitrobenzamide.
| Compound Name | N-[5-[2-[(3-bromobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-3-nitrobenzamide |
|---|---|
| PubChem CID | 17193269 |
| Molecular Formula | C19H16BrN5O5S |
| Molecular Weight | 506.34 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | N-[5-[2-[(3-bromobenzoyl)amino]ethyl]-1,3,4-thiadiazol-2-yl]-4-methoxy-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)Nc2nnc(CCNC(=O)c3cccc(Br)c3)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16BrN5O5S/c1-30-15-6-5-12(10-14(15)25(28)29)18(27)22-19-24-23-16(31-19)7-8-21-17(26)11-3-2-4-13(20)9-11/h2-6,9-10H,7-8H2,1H3,(H,21,26)(H,22,24,27) |
| InChIKey | VWYNNPLVFSKGSW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|