C21H19N5O5S — CID 17193532
3-methoxy-N-[2-[5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide (PubChem CID 17193532) has the molecular formula C21H19N5O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is 3-methoxy-N-[2-[5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide.
| Compound Name | 3-methoxy-N-[2-[5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 17193532 |
| Molecular Formula | C21H19N5O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 3-methoxy-N-[2-[5-[[(E)-3-(4-nitrophenyl)prop-2-enoyl]amino]-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
| SMILES | COc1cccc(C(=O)NCCc2nnc(NC(=O)/C=C/c3ccc([N+](=O)[O-])cc3)s2)c1 |
| InChI | InChI=1S/C21H19N5O5S/c1-31-17-4-2-3-15(13-17)20(28)22-12-11-19-24-25-21(32-19)23-18(27)10-7-14-5-8-16(9-6-14)26(29)30/h2-10,13H,11-12H2,1H3,(H,22,28)(H,23,25,27)/b10-7+ |
| InChIKey | PUSDCDVPKATZBL-JXMROGBWSA-N |
| XLogP | 3.08 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|