C45H40N8O6 — CID 10259687
3-[(3-aminobenzoyl)amino]-N-[3-[[3-[(3-aminobenzoyl)amino]-5-benzamidobenzoyl]amino]propyl]-5-benzamidobenzamide (PubChem CID 10259687) has the molecular formula C45H40N8O6 and a molecular weight of 788.87 g/mol. Its IUPAC name is 3-[(3-aminobenzoyl)amino]-N-[3-[[3-[(3-aminobenzoyl)amino]-5-benzamidobenzoyl]amino]propyl]-5-benzamidobenzamide.
| Compound Name | 3-[(3-aminobenzoyl)amino]-N-[3-[[3-[(3-aminobenzoyl)amino]-5-benzamidobenzoyl]amino]propyl]-5-benzamidobenzamide |
|---|---|
| PubChem CID | 10259687 |
| Molecular Formula | C45H40N8O6 |
| Molecular Weight | 788.87 g/mol |
| Exact Mass | 788.31 |
| IUPAC Name | 3-[(3-aminobenzoyl)amino]-N-[3-[[3-[(3-aminobenzoyl)amino]-5-benzamidobenzoyl]amino]propyl]-5-benzamidobenzamide |
| SMILES | Nc1cccc(C(=O)Nc2cc(NC(=O)c3ccccc3)cc(C(=O)NCCCNC(=O)c3cc(NC(=O)c4ccccc4)cc(NC(=O)c4cccc(N)c4)c3)c2)c1 |
| InChI | InChI=1S/C45H40N8O6/c46-34-16-7-14-30(20-34)44(58)52-38-24-32(22-36(26-38)50-42(56)28-10-3-1-4-11-28)40(54)48-18-9-19-49-41(55)33-23-37(51-43(57)29-12-5-2-6-13-29)27-39(25-33)53-45(59)31-15-8-17-35(47)21-31/h1-8,10-17,20-27H,9,18-19,46-47H2,(H,48,54)(H,49,55)(H,50,56)(H,51,57)(H,52,58)(H,53,59) |
| InChIKey | UBFKPAVPIFTVPX-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 226.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.87 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|